
هذا المقال يتضمن أسماءً أعجمية تتطلب حروفاً إضافية (پ چ ژ گ ڤ ڠ).
لمطالعة نسخة مبسطة، بدون حروف إضافية
اسم أيوپاك
أسماء أخرى
2-Amino-4-methylpentanoic acid
رقم CAS [61-90-5]
PubChem 6106
بنك الأدوية DB01746
KEGG D00030
ChEBI 57427
InChI InChI=1/C6H13NO2/c1-4(2)3-5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t5-/m0/s1
الصيغة الجزيئية C6H13NO2
كتلة مولية 131.16 g mol-1
الحموضة (pKa) 2.36 (carboxyl), 9.60 (amino)[1]
القابلية المغناطيسية -84.9·10−6 cm3/mol
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
X mark.svgN verify (what is YesYX mark.svgN ?)
مراجع الجدول

ليوسين Leucine (يُختصر Leu أو L)، هو الحمض الأميني الذي يستخدم في تخليق الپروتينيات حيوياً. ويحتوي على مجموعة أمين-ألفا (والموجودة في صيغة NH3+-الپروتونية تحت ظروف بيولوجية)، مجموعة حمضية كربوكسيلية (والتي توجد في صيغة −COO لا پروتونية تحت ظروف حيوية)، ومجموعة أيزوبوتيل جانبية السلسلة، مما يجعله حمض أميني أليفاتي غير قطبي. وهو أحد الأحماض الأمينية الأساسية في الجسم البشري، مما يعني أنه لا يمكن للجسم تخليقه: ينبغي أن يحصل عليه من خلال النظام الغذائي. المصادر الغذائية البشرية هي الأغذية التي تحتوي على پروتينات، مثل اللحوم، منتجات الألبان، منتجات الصويا، الفول والبقوليات. في الشفرة الوراثية يشفر الليوسين بستة كودونات، هي UUA، UUG، CUU، CUC، CUA، وCUG.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

علم الأحياء

يستخدم الليوسين في الكبد، الأنسجة الدهنية، والأنسجة العضلية. الأنسجة الدهنية والعضلية تستخدم الليوسين في تكوين السترولات. يستخدم الليوسين المركب في هذين النسيجين سبعة أضعاف الليوسين المستخدم في الكبد.[2]

ينتقل الليوسين بسرعة للمخ حيث تحوله الخلايا النجمية إلى ألفا-كيتوأيزوكاپورات عبر تحويل ألفا-الكيتوگلوتارت إلى گلوتامات.[3]

التخليق الحيوي في النباتات

الليوسين هو حمض أميني أساسي في النظام الغذائي للحيوانات لافتقادهم مسار الانزيم الكامل لتخليقه من مركبات السلائف المحتملة. بناءاً على ذلك، ينبغي عليهم تناوله، عادة كمركب پروتيني. تخلق النباتات والعضيات الدقيقة الليوسين من حمض الپيروڤيك عن طريق سلسلة من الانزيمات:[4]

الأيض في البشر

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .




المصادر الغذائية

المصادر الغذائية لليسين[8]
الغذاء گ/100گ
پروتين مصل اللبن المركز، المسحوق المجفف 10.0-12.0
پروتين الصويا المركز، المسحوق المجفف 7.5-8.5
فول الصويا البذور، المسحوق، المملح 2.87
القنب البذور، المقشر 2.16
لحم البقر، المطهي، النيء 1.76
الفول السوداني 1.67
الأسماك، السلمون، الناضج، النيء 1.62
جنين القمح 1.57
اللوز 1.49
الدجاج، المسلوق أو المقلي، الأفخاذ، النيء 1.48
بيض الدجاج، المح، النيء 1.40
الشعير 1.28
الإدامامي (فول الصويا، الخضراء، النيئة) 0.93
الحبوب، المطهوة 0.78
العدس، المطهو 0.65
الحمص، المطهو 0.63
الذرة، الصفراء 0.35
حليب الأبقار، الكامل الدسم، 2.25% دهن الحليب 0.27
الأرز، البني، المطهو 0.19
الحليب، البشري، البالغون، السائل 0.10

الخصائص الكيميائية

(S)-Leucine (or L-leucine), left; (R)-leucine (or D-leucine), right, in zwitterionic form at neutral pH

استخدامات أخرى

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

انظر أيضاً


  1. ^ Dawson, R.M.C., et al., Data for Biochemical Research, Oxford, Clarendon Press, 1959.
  2. ^ J. Rosenthal, et al. Department of Medicine, University of Toronto, Toronto, Canada. "Metabolic fate of leucine: A significant sterol precursor in adipose tissue and muscle". American Journal of Physiology Vol. 226, No. 2, p. 411-418. Retrieved 25 March 2008.CS1 maint: multiple names: authors list (link)
  3. ^ [reference: Yudoff, Mark. (Feb 01 2017) "Interactions in the Metabolism of Glutamate and the Branched-Chain Amino Acids and ketoacids in the CNS" Neurochem Res. 2017 January; 42(1): 10-18. doi:10.1007/s11064-016-2057-z. ]
  4. ^ Nelson, D. L.; Cox, M. M. "Lehninger, Principles of Biochemistry" 3rd Ed. Worth Publishing: New York, 2000. ISBN 1-57259-153-6.
  5. ^ أ ب Wilson JM, Fitschen PJ, Campbell B, Wilson GJ, Zanchi N, Taylor L, Wilborn C, Kalman DS, Stout JR, Hoffman JR, Ziegenfuss TN, Lopez HL, Kreider RB, Smith-Ryan AE, Antonio J (February 2013). "International Society of Sports Nutrition Position Stand: beta-hydroxy-beta-methylbutyrate (HMB)". Journal of the International Society of Sports Nutrition. 10 (1): 6. doi:10.1186/1550-2783-10-6. PMC 3568064. PMID 23374455.
  6. ^ أ ب Kohlmeier M (May 2015). "Leucine". Nutrient Metabolism: Structures, Functions, and Genes (2nd ed.). Academic Press. pp. 385–388. ISBN 978-0-12-387784-0. Retrieved 6 June 2016. Energy fuel: Eventually, most Leu is broken down, providing about 6.0kcal/g. About 60% of ingested Leu is oxidized within a few hours ... Ketogenesis: A significant proportion (40% of an ingested dose) is converted into acetyl-CoA and thereby contributes to the synthesis of ketones, steroids, fatty acids, and other compounds
    Figure 8.57: Metabolism of L-leucine
  7. ^ National Nutrient Database for Standard Reference. U.S. Department of Agriculture. Archived from the original on 3 March 2015. Retrieved 16 September 2009. Unknown parameter |deadurl= ignored (help)

وصلات خارجية