كلوروفورم

كلوروفورم
Chloroform displayed.svg
Chloroform 3D.svg
الأسماء
اسم أيوپاك
Chloroform
اسم أيوپاك النظامي
Trichloromethane
أسماء أخرى
Formyl trichloride, Methane trichloride, Methyl trichloride, Methenyl trichloride, TCM, Freon 20, R-20, UN 1888
تمييز
رقم CAS [67-66-3]
PubChem 6212
رقم EC 200-663-8
KEGG C13827
ChEBI 35255
رقم RTECS FS9100000
SMILES
InChI InChI=1/CHCl3/c2-1(3)4/h1H
الخصائص
الصيغة الجزيئية CHCl3
كتلة مولية 119.38 g/mol
المظهر Colorless liquid
الكثافة 1.48 g/cm3
نقطة الانصهار

-63.5 °C

نقطة الغليان
قابلية الذوبان في الماء 0.8 g/100 ml (20 °C)
معامل الانكسار (nD) 1.4459
البنية
الشكل الجزيئي Tetrahedral
المخاطر
خطر رئيسي ضار (Xn), مثير (Xi), سام من الفئة 2B
توصيف المخاطر R22, R38, R40, قالب:R48/20/22
تحذيرات وقائية (S2), S36/37
نقطة الوميض غير قابل للاشتعال
حدود التعرض الصحية بالولايات المتحدة (NIOSH):
PEL (المسموح)
50 ppm (240 mg/m3) (OSHA)
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
مراجع الجدول

كلوروفورم Chloroform هو مركب عضوي صيغته CHCl3. ولا يشتعل في الهواء، بالرغم من أنه يشتعل لو خـُلِط بمواد أكثر قابلية للاشتعال. وهو عضو في مجموعة مركبات معروفة باسم تراي هالوميثانات. وللكلوروفورم عدد هائل من الاستخدامات كreagent وكمذيب. ويعتبر أيضاً خطراً بيئياً. ويـُنتج منه ملايين الأطنان كل سنة.[1]

الكلوروفورم سائلٌ كثيفٌ عديم اللون يُستخدم مذيبًا في صناعة الأدوية والأصباغ والمبيدات الحشرية. ويستخدم الكلوروفورم أيضًا كمادة أساسية لصناعة الفلوروكربونات. وكان الكلوروفورم قد استخدم فيما مضى مبنجًا جراحيًا.

وفي كثير من الأقطار، يحظر استخدام الكلوروفورم في الأغذية والعقاقير ومستحضرات التجميل. فقد أوضحت الاختبارات أنَّ التعرض لجرعات عالية من الكلوروفورم يسبِّب إصابة حيوانات المختبَر بداء السرطان.

وفي عام 1831م، اكتشف ثلاثة كيميائيين كلٌّ على حدة، مادة الكلوروفورم؛ وهم الفرنسي اوجين سوبيران، والألماني يوستوس فون ليبگ، والأمريكي صموئيل گثري. وفي عام 1847م، عرض السير جيمس يونج سمپسون على الجمهور كيفية استخدام الكلوروفورم مبنجًا جراحيًا. وساعدت الملكة فكتوريا في استصدار الموافقة على استخدامه في الطب مسكنًا للألم ومخدرًا عامًا. ولأنَّ الكلوروفورم قد يضر القلب والكبد والكليتين، فقد حلت محله في الطب الحديث مبنجات أقل ضررًا.

والصيغة الكيميائية للكلوروفورم CHCl3. وهو يغلي عند درجة حرارة 62°م، ويتجمد عند درجة -64°م.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

المصادر

  1. ^ M. Rossberg et al. “Chlorinated Hydrocarbons” in Ullmann’s Encyclopedia of Industrial Chemistry 2006, Wiley-VCH, Weinheim. doi:10.1002/14356007.a06_233.pub2

وصلات خارجية