كربونات الباريوم

هذا المقال يتضمن أسماءً أعجمية تتطلب حروفاً إضافية (پ چ ژ گ ڤ ڠ).
لمطالعة نسخة مبسطة، بدون حروف إضافية
Barium carbonate
Skeletal formula of barium carbonate
Powder of barium carbonate
الأسماء
أسماء أخرى
تمييز
رقم CAS [513-77-9]
PubChem 10563
رقم EC 208-167-3
رقم RTECS CQ8600000
SMILES
InChI InChI=1/CH2O3.Ba/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2
الخصائص
الصيغة الجزيئية BaCO3
كتلة مولية 197.34 g/mol
المظهر white crystals
الرائحة odorless
الكثافة 4.286 g/cm3
نقطة الانصهار
نقطة الغليان
قابلية الذوبان في الماء 16 mg/L (8.8°C)
22 mg/L (18 °C)
24 mg/L (20 °C)
24 mg/L (24.2 °C)[1]
نتاج قابلية الذوبان، Ksp 2.58·10−9
قابلية الذوبان decomposes in acid
insoluble in methanol
القابلية المغناطيسية -58.9·10−6 cm3/mol
معامل الانكسار (nD) 1.676
الكيمياء الحرارية
الإنتالپية المعيارية
للتشكل
ΔfHo298
-1219 kJ/mol[2]
Standard molar
entropy
So298
112 J/mol·K[2]
سعة الحرارة النوعية، C 85.35 J/mol·K[1]
المخاطر
صفحة بيانات السلامة ICSC 0777
ن.م.ع. مخطط تصويري The exclamation-mark pictogram in the Globally Harmonized System of Classification and Labelling of Chemicals (GHS)[3]
ن.م.ع. كلمة الاشارة Warning
H302[3]
NFPA 704 (معيـَّن النار)
نقطة الوميض Non-flammable
الجرعة أو التركيز القاتل (LD, LC):
418 mg/kg, oral (rat)
مركبات ذا علاقة
Beryllium carbonate
Magnesium carbonate
Calcium carbonate
Strontium carbonate
Radium carbonate
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
X mark.svgN verify (what is YesYX mark.svgN ?)
مراجع الجدول

كربونات الباريوم هو مركب كيميائي له الصيغة BaCO3 ، ويكون على شكل مسحوق بلوري أبيض ناعم.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

الخواص

BaCO3 → BaO + CO2


تواجده في الطبيعة

يوجد مركب كربونات الباريوم في الطبيعة في فلز الويذيريت (witherite) نسبة ًإلى ويليام ويذيرينغ الذي كان أول من ميزه عن فلز الباريت .

التحضير

يحضر مركب كربونات الباريوم من تمرير غاز ثنائي أكسيد الكربون في محلول من كبريتيد الباريوم

BaS + CO2 + H2O → BaCO3 + H2S

أو من تفاعل كربونات الصوديوم مع كبريتيد الباريوم حسب المعادلة

BaS + Na2CO3 → BaCO3 + Na2S

وفي كلتا الحالتين يتشكل لدينا راسب أبيض من كربونات الباريوم.

الاستخدامات

MgSO4 + CaSO4 + 2BaCO3 → CaCO3 + MgCO3 + 2BaSO4
  • يستعمل مركب كربونات الباريوم أيضاً في صناعة الزجاج وذلك للوصول إلى ميزات وخصائص بصرية وكيميائية.

السلامة

مركب كربونات الباريوم مركب سام مثل كل أملاح الباريوم المنحلة.

الهامش

  1. ^ أ ب خطأ استشهاد: وسم <ref> غير صحيح؛ لا نص تم توفيره للمراجع المسماة chemister
  2. ^ أ ب Zumdahl, Steven S. (2009). Chemical Principles 6th Ed. Houghton Mifflin Company. ISBN 978-0-618-94690-7.
  3. ^ أ ب Sigma-Aldrich Co., Barium carbonate. Retrieved on 2014-05-06.
  4. ^ Sciences labs MSDS

[1]

المصادر

Taschenbuch chemische Substanzen, Willmes, Verlag Harri Deutsch, ISBN 3-8171-1662-4

H2CO3 He
Li2CO3 BeCO3 B C N O F Ne
Na2CO3 MgCO3 Al Si P S Cl Ar
K2CO3 CaCO3 Sc Ti V Cr MnCO3 FeCO3 CoCO3 NiCO3 CuCO3 ZnCO3 Ga Ge As Se Br Kr
Rb2CO3 SrCO3 Y Zr Nb Mo Tc Ru Rh Pd Ag2CO3 CdCO3 In Sn Sb Te I Xe
Cs2CO3 BaCO3 Hf Ta W Re Os Ir Pt Au Hg Tl2CO3 PbCO3 Bi Po At Rn
Fr Ra Rf Db Sg Bh Hs Mt Ds Rg Cn Uut Uuq Uup Uuh Uus Uuo
La2(CO3)3 Ce Pr Nd Pm Sm Eu Gd Tb Dy Ho Er Tm Yb Lu
Ac Th Pa U Np Pu Am Cm Bk Cf Es Fm Md No Lr


الكلمات الدالة: