كربونات الليثيوم

هذا المقال يتضمن أسماءً أعجمية تتطلب حروفاً إضافية (پ چ ژ گ ڤ ڠ).
لمطالعة نسخة مبسطة، بدون حروف إضافية
Lithium carbonate
Lithium carbonate
Lithium-carbonate-xtal-1979-Mercury-3D-sf.png
الأسماء
اسم أيوپاك
Lithium carbonate
أسماء أخرى
Dilithium carbonate, Carbolith, Cibalith-S, Duralith, Eskalith, Lithane, Lithizine, Lithobid, Lithonate, Lithotabs Priadel, Zabuyelite
تمييز
رقم CAS [554-13-2]
PubChem 11125
KEGG D00801
ChEBI 6504
رقم RTECS OJ5800000
SMILES
InChI InChI=1/CH2O3.2Li/c2-1(3)4;;/h(H2,2,3,4);;/q;2*+1/p-2
الخصائص
الصيغة الجزيئية Li 2CO 3
كتلة مولية 73.89
المظهر مسحوق أبيض عديم الرائحة
الكثافة 2.11 g/cm3
نقطة الانصهار
نقطة الغليان
قابلية الذوبان في الماء 1.54 g/100 mL (0 °س)
1.43 g/100 mL (10 °س)
1.29 g/100 mL (25 °C)
1.08 g/100 mL (40 °C)
0.69 g/100 mL (100 °س)[1]
قابلية الذوبان Insoluble in أسيتون، أمونيا، الكحول[2]
معامل الانكسار (nD) 1.428[3]
اللزوجة 4.64 cP (777 °س)
3.36 cP (817 °س)[2]
الكيمياء الحرارية
الإنتالپية المعيارية
للتشكل
ΔfHo298
-1215.6 kJ/mol[2]
Standard molar
entropy
So298
90.37 J/mol·K[2]
سعة الحرارة النوعية، C 97.4 J/mol·K[2]
المخاطر
خطر رئيسي Irritant
صفحة بيانات السلامة ICSC 1109
ن.م.ع. مخطط تصويري The exclamation-mark pictogram in the Globally Harmonized System of Classification and Labelling of Chemicals (GHS)[4]
ن.م.ع. كلمة الاشارة Warning
H302, H319[4]
P305+351+338[4]
ضار Xn مثير Xi
توصيف المخاطر R22, R36
تحذيرات وقائية S26, S36/37
نقطة الوميض غير قابل للاشتعال
الجرعة أو التركيز القاتل (LD, LC):
525 mg/kg (oral, rat)[5]
مركبات ذا علاقة
كربونات الصوديوم
كربونات الپوتاسيوم
كربونات الروبيديوم
كربونات السيزيوم
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
X mark.svgN verify (what is YesYX mark.svgN ?)
مراجع الجدول

كربونات الليثيوم Lithium carbonate مركب كيميائي له الصيغة Li2CO3 ، ويكون على شكل مسحوق أبيض.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

التحضير

يحضر مركب كربونات الليثيوم من تفاعل كربونات الصوديوم مع أحد أملاح الليثيوم المنحلة حسب المعادلة:


الخواص

  • بالتسخين يتفكك كربونات الليثيوم إلى أكسيد الليثيوم مع تحرر غاز ثنائي أكسيد الكربون

الاستخدامات

المصادر

  1. ^ Seidell, Atherton; Linke, William F. (1952). Solubilities of Inorganic and Organic Compounds. Van Nostrand.
  2. ^ أ ب ت ث ج خطأ استشهاد: وسم <ref> غير صحيح؛ لا نص تم توفيره للمراجع المسماة chemister
  3. ^ Pradyot Patnaik. Handbook of Inorganic Chemicals. McGraw-Hill, 2002, ISBN 0-07-049439-8
  4. ^ أ ب ت Sigma-Aldrich Co., Lithium carbonate. Retrieved on 2014-06-03.
  5. ^ http://chem.sis.nlm.nih.gov/chemidplus/rn/554-13-2
  • Taschenbuch chemische Substanzen, Willmes, Verlag Harri Deutsch, ISBN 3-8171-1662-4

قالب:Oxytocin and vasopressin receptor modulators