
Ball-and-stick model of acetone
Space-filling model of acetone
اسم أيوپاك
أسماء أخرى
β-ketopropane, dimethyl ketone, dimethylformaldehyde, DMK, 'propanone, 2-propanone, propan-2-one, β-ketopropane
رقم CAS [67-64-1]
رقم RTECS AL31500000
InChI InChI=1/C3H6O/c1-3(2)4/h1-2H3
الصيغة الجزيئية C3H6O
كتلة مولية 58.07 g mol-1
المظهر Colorless liquid
الكثافة 0.79 g/cm3
نقطة الانصهار
نقطة الغليان
قابلية الذوبان في الماء miscible
اللزوجة 0.32 cP at 20 °C
الشكل الجزيئي trigonal planar at C=O
Dipole moment 2.91 D
قابل للاشتعال F
مثير Xi
توصيف المخاطر R11, R36, R66, R67
تحذيرات وقائية (S2), S9, S16, S26
NFPA 704 (معيـَّن النار)
Flammability code 3: سوائل ومواد صلبة يمكن اشتعالها تقريباً تحت ظروف أي درجة حرارة محيطة. نقطة الوميض بين 23 و 38 °س (73 و 100 °ف). مثل الگاسولينHealth code 1: التعرض سيتسبب في تهيجاً ولكن لا يترك سوى جروح طفيفة باقية. مثل زيت الترپنتينReactivity code 0: مستقر في العادة، حتى تحت ظروف التعرض للنار، ولا يتفاعل مع الماء. مثل النيتروجين السائلSpecial hazards (white): no codeNFPA 704 four-colored diamond
نقطة الوميض -17 °C
حدود الانفجار 4.0–57.0
مركبات ذا علاقة
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
مراجع الجدول

الأسيتون بالإنگليزية: Acetone (يعرف أيضاً بالبروبانون أو كيتون ثنائي الميثيل أو 2-بروبانون أو بيتا كيتو بروبانون) بالصيغة CH3COCH3 هو مركب كيميائي عضوي يتبع لعائلة الكيتونات ويعتبر أبسط ممثل لهذه العائلة. الأسيتون سائل عديم اللون قابل للإشتعال ودرجة إنصهاره −95.4 °C ودرجة غليانه 56.53 °C. يعتبر استخدامه كمزيل لطلاء الأظافر من أشهر الاستخدامات المنزلية. كما يستخدم الأسيتون في صناعة اللدائن ، الألياف ، الأدوية وكيماويات أخرى. يذوب الأسيتون في المياه والكحول والإيثر. ويعتبر الأسيتون مذيباً عضوياً هاماً.

وتفيد احدى الدرسات بأن الأسيتون خطر جداً ومسبب رئيسي للسرطان وغير صالح للإستخدام البشري بتاتا ويذكر انه تم منعه في بعض البلدان وسحبه من الأسواق[بحاجة لمصدر].

الأسيتون مادة كيميائية صناعية مهمة، تستعمل أساسًا في تحضير مركبات أخرى. تقوم المؤسسات الصناعية بتحضير الأسيتون بكميات تجارية من الكحول الآيسوبروبيلي مستعملة الصُّفْر والنحاس كمواد مساعدة. كما أن الذرة ومنتجات نشوية أخرى تُعَدُّ كذلك مصادر للأسيتون. وللحصول على الأسيتون، تُخمَّرُ هذه الموادّ بوضع بكتيريا خاصة عليها ثم يتم تقطيرها.

يتكون الأسيتون كذلك في جسم مريض السكر، ووجوده في البول إحدى دلالات المرض.

يذيب الأسيتون كثيرا من المواد، بما في ذلك الصمغ والنفط والراتينج والشحوم والسليلوز. وتستخدم الصناعة الأسيتون في الأصباغ ومزيلات الورنيش وبعض المزيلات ومواد الطلاء. وتحتوي مادة طلاء الأظافر والمادة المزيلة لها على نسبة وافرة من الأسيتون. وبسبب قدرته على إذابة السليلوز، فإنّ الأسيتون يلعب دورًا مهمًا في إنتاج أنواع معينة من مواد نسيج الرايون.

لا يمكن استخدام غاز الأسيتيلين بأمان في الصناعة دون وجود الأسيتون؛ فهذا الغاز كثيراً ما ينفجر من تلقاء نفسه، حين يتعرض للضغط. لكن يمكن تخزينه بأمانٍ في حاويات مليئة بالأسبستوس المغمور في الأسيتون. ويذيب الأسيتون الأسيتيلين تحت الضغط ويطلقه عند الحاجة حين تفتح الحاوية.

والأسيتون سائل شفاف لا لون له، قابل للاشتعال، وله رائحة أشبه برائحة الفاكهة. وهو المركب الأول من سلسلة المركبات العضوية المعروفة باسم الكيتونات. ويمتزج الأسيتون بسهولة بالماء، وصيغته الكيميائية هي: (Ch3CoCh3)، ويغلي في درجة حرارة 56,2 درجة مئوية.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .


  1. ^ Merck Index, 11th Edition, 58.

وصلات خارجية

انظر أيضًا