خلات الپوتاسيوم

هذا المقال يتضمن أسماءً أعجمية تتطلب حروفاً إضافية (پ چ ژ گ ڤ ڠ).
لمطالعة نسخة مبسطة، بدون حروف إضافية
Potassium acetate
Skeletal formula of potassium acetate
الأسماء
أسماء أخرى
ملح البوتاسيوم، E261
تمييز
رقم CAS [127-08-2]
PubChem 31371
SMILES
InChI InChI=1/C2H4O2.K/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1
الخصائص
الصيغة الجزيئية C2H3KO2
كتلة مولية 98.13 g mol-1
المظهر مسحوق بلوري deliquescent أبيض
الكثافة 1.8 g/cm3 (20 °C)[1]
1.57 g/cm3 (25 °C)
نقطة الانصهار
نقطة الغليان
قابلية الذوبان في الماء 216.7 g/100 mL (0.1 °C)
233.8 g/100 mL (10 °C)
268.6 g/100 mL (25 °C)
320.8 g/100 mL (40 °C)
390.7 g/100 mL (96 °C)[2]
قابلية الذوبان قابل للذوبان في الكحول، والأمونيا السائلة
غير قابل للذوبان في الإيثر، أو الأسيتون
قابلية الذوبان في ميثانول 24.24 g/100 g (15 °C)
53.54 g/100 g (73.4 °C)[1]
قابلية الذوبان في إيثانول 16.3 g/100 g[1]
قابلية الذوبان في ثاني أكسيد الكبريت 0.06 g/kg (0 °C)[1]
الحموضة (pKa) 4.76
البنية
البنية البلورية أحادي الميل
الكيمياء الحرارية
الإنتالپية المعيارية
للتشكل
ΔfHo298
−722.6 kJ/mol[1]
Standard molar
entropy
So298
150.82 J/mol·K[3]
سعة الحرارة النوعية، C 109.38 J/mol·K[3]
المخاطر
NFPA 704 (معيـَّن النار)
Flammability code 1: لابد أن يكون ساخناً مسبقاً قبل أن يحدث اشتعال. نقطة الوميض فوق 93 °س (200 °ف). مثل زيت الكانولاHealth code 2: التعرض الشديد أو المتواصل ولكن ليس بمزمن قد يتسبب في عجز مؤقت أو جرح بُحتمل بقاؤه. مثل الكلوروفورمReactivity code 0: مستقر في العادة، حتى تحت ظروف التعرض للنار، ولا يتفاعل مع الماء. مثل النيتروجين السائلSpecial hazards (white): no codeNFPA 704 four-colored diamond
1
2
0
الجرعة أو التركيز القاتل (LD, LC):
3250 mg/kg (oral, rat)[4]
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
X mark.svgN verify (what is YesYX mark.svgN ?)
مراجع الجدول

خلات بوتاسيوم مركب كيميائي له الصيغة CH3COOK ، ويكون على شكل مسحوق بلوري أبيض.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

الخواص

  • تكون على شكل بلورات عديمة اللون والرائحة، تتسيل بسهولة لدى تماسها مع الهواء.
  • ينحل مركب خلات البوتاسيوم بشكل جيد جداً في الماء (200 غ لكل 100 مل ماء عند الدرجة 20°س)، كما ينحل بشكل جيد في الإيثانول.
  • المحاليل المائية منه لها صفة قلوية حيث أن الأس الهيدروجيني 0.1 نظامي مقداره 9.7.


التحضير

يحضر مركب خلات البوتاسيوم من تفاعل تعديل حمض الخليك مع كربونات البوتاسيوم من ثم تبخير المحلول الناتج

3H3C-COOH + K2CO3 → 2H3C-COO - K + + H2O + CO2

الاستخدامات

المصادر

  • Taschenbuch chemische Substanzen, Willmes, Verlag Harri Deutsch, ISBN 3-8171-1662-4



  1. ^ أ ب ت ث ج http://chemister.ru/Database/properties-en.php?dbid=1&id=504
  2. ^ Seidell, Atherton; Linke, William F. (1952). Solubilities of Inorganic and Organic Compounds. Van Nostrand.
  3. ^ أ ب قالب:Nist
  4. ^ http://chem.sis.nlm.nih.gov/chemidplus/rn/127-08-2