أوكسالات الكالسيوم

Calcium oxalate
Calcium oxalate
The ball-and-stick model of calcium oxalate
الأسماء
اسم أيوپاك
Calcium oxalate
تمييز
رقم CAS [5794-28-5]
PubChem 16212978
ChEBI 60579
SMILES
InChI InChI=1/C2H2O4.Ca/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2
الخصائص
الصيغة الجزيئية CaC2H2O5 (monohydrate)
CaC2O4 (anhydrous)
المظهر صلب ابيض
الكثافة 2.20 g/cm3, monohydrate[1]
نقطة الانصهار
قابلية الذوبان في الماء 0.67 mg/L (20 °C)
المخاطر
خطر رئيسي ضار، مهيج
NFPA 704 (معيـَّن النار)
Flammability code 1: لابد أن يكون ساخناً مسبقاً قبل أن يحدث اشتعال. نقطة الوميض فوق 93 °س (200 °ف). مثل زيت الكانولاHealth code 2: التعرض الشديد أو المتواصل ولكن ليس بمزمن قد يتسبب في عجز مؤقت أو جرح بُحتمل بقاؤه. مثل الكلوروفورمReactivity code 0: مستقر في العادة، حتى تحت ظروف التعرض للنار، ولا يتفاعل مع الماء. مثل النيتروجين السائلSpecial hazards (white): no codeNFPA 704 four-colored diamond
1
2
0
مركبات ذا علاقة
كربونات الكالسيوم
خلات الكالسيوم
فورمات الكالسيوم
أوكسالات الصوديوم
أوكسالات البريليوم
أوكسالات المغنسيوم
أوكسالات السترونشم
أوكسالات الباريوم
أوكسالات الراديوم
أوكسالات الحديد الثنائي
أوكسالات الحديد الثلاثي
مركـّبات ذات علاقة
حمض الأوكساليك
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
X mark.svgN verify (what is YesYX mark.svgN ?)
مراجع الجدول
Scanning electron micrograph of the surface of a kidney stone showing tetragonal crystals of Weddellite (calcium oxalate dihydrate) emerging from the amorphous central part of the stone (the horizontal length of the picture represents 0.5 mm of the figured original)
Portion of CaC2O4·2H2O lattice, highlighting the connectivity of the oxalate ligand.[1](Carbon: black; Oxygen: red; Calcium: green)

اوكسالات كالسيوم Calcium Oxalate هو مركب كيميائي له الصيغة CaC2O4 ، ويكون على شكل مسحوق بلوري أبيض إبري، وهو ملح الكالسيوم لحمض الأكساليك. يوجد منه شكل مائي أحادي الهيدرات، حيث تدخل جزيئة ماء في البنية البلورية.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

الخواص


الوفرة الطبيعية والتحضير

يدخل مركب أكسالات الكالسيوم في تركيب الحصى الكلوية. كما يوجد في بعض النباتات مثل ديفنباخيا، كما يوجد في بعض أوراق الراوند. يمكن أن يعثر على مركب أكسالات الكالسيوم في الطبيعة أيضاً على شكل معدن هيويليت Whewellite.

بلورات اوكسالات الكالسيوم في عينة بولية مكبرة تحت المجهر

يحضر اوكسالات البوتاسيوم مخبرياً كناتج ثانوي من عملية تحضير حمض الأكساليك، حيث يتفاعل أكسالات الصوديوم مع هيدروكسيد الكالسيوم حيث يترسب اوكسالات الكالسيوم من المحلول. للحصول على حمض الاوكساليك يضاف حمض الكبريتيك لاحقاً.

Na2C2O4 + Ca(OH)2 → CaC2O4 + 2NaOH

الاستخدامات

نظراً لعدم انحلالية مركب أكسالات الكالسيوم فإنه يستخدم في الكيمياء التحليلية للتحليل الكمي لأيونات الكالسيوم.

المصادر

  • موسوعة رومب الكيميائية Römpp Lexikon Chemie, Georg Thieme Verlag

المراجع

  1. ^ أ ب S. Deganello (1981). "The Structure of Whewellite, CaC2O4.H2O, at 328 K". Acta Crystallogr. B. 37: 826–829. doi:10.1107/S056774088100441X.