أدنين

(تم التحويل من أدينين)
أدنين
Adenine chemical structure.png
Adenine-3D-balls.png
Adenine-3D-vdW.png
Adenine 3D Ball-and-stick Model.JPG
الأسماء
اسم أيوپاك
9H-purin-6-amine
أسماء أخرى
6-aminopurine
تمييز
رقم CAS [73-24-5]
PubChem 190
SMILES
InChI InChI=1/C5H5N5/c6-4-3-5(9-1-7-3)10-2-8-4/h1-2H,(H3,6,7,8,9,10)
الخصائص
الصيغة الجزيئية C5H5N5
كتلة مولية 135.13 g/mol
نقطة الانصهار

360–65 °C

ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
YesY verify (what is YesYX mark.svgN ?)
مراجع الجدول

الأدنين Adenine هو پيورين له وظائف عديدة في الكيمياء الحيوية منها التنفس الخلوي، في صيغة كل من ثلاثي فوسفات الأدنوسين adenosine triphosphate - ATP وتمائم العوامل nicotinamide adenine dinucleotide (NAD) و flavin adenine dinucleotide (FADوتخليق البروتين، كمكوّن كيميائي في دنا و رنا.[1]

وهو من مجموعة البيورينات يرتبط مع الثيامين (من البيرميدينات) برابطتين هيدروجينيتين .

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

وصلات خارجية


المصادر