
اسم أيوپاك
أسماء أخرى
DM, diphenylaminechlorarsine
رقم CAS [578-94-9]
PubChem 11362
InChI InChI=1/C12H9AsClN/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,15H
الصيغة الجزيئية C12H9AsClN
المظهر yellow-to-green crystals
نقطة الانصهار
نقطة الغليان
قابلية الذوبان في الماء 0,0064 g/100 g
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
مراجع الجدول

أدامسيت مركب عضوي له الصيغة HN-(C6H4)2-AsCl، ويكون على شكل بلورات صفراء إلى خضراء .

أكتشفه الأمريكي روجر ادمز وهو مركب ذو استعمالات حربية

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .





وصلات خارجية