بينزيل أسيتون

(تم التحويل من Benzylacetone)
بينزيل أسيتون
Benzylacetone.png
الأسماء
اسم أيوپاك المفضل
4-Phenylbutan-2-one
أسماء أخرى
4-Phenyl-2-butanone
Methyl 2-phenylethyl ketone
تمييز
رقم CAS [2550-26-7]
PubChem 17355
SMILES
InChI InChI=1/C10H12O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3
الخصائص
الصيغة الجزيئية C10H12O
كتلة مولية 148.2 g mol-1
الكثافة 0.989 گ/م.ل.
نقطة الانصهار
نقطة الغليان
المخاطر
نقطة الوميض 98 °م (208 °ف; 371 ك)
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
X mark.svgN verify (what is YesYX mark.svgN ?)
مراجع الجدول

البينزيل أسيتون Benzylacetone (تسمية الإيوپاك: 4-phenylbutan-2-one)، هو سائل حلو المذاق، ذو رائحة زهرية ويعتبر المركب الجاذب الأكثر وفرة في الزهور (مثل Coyote Tobacco, Nicotiana attenuata)[1][2] وواحداً من المكونات المتطايرة في الكاكاو.[3]

يمكن استخدامه كجاذب لذبابة البطيخ،[4][5] في العطور،[6] وكمادة معطرة في الصابون.


يمكن تحضيره بهدرجة البنزيليدن أسيتون.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

انظر أيضاً


المصادر

  1. ^ Kessler, D. & Baldwin, I.T. (2007). "Making sense of nectar scents: the effects of nectar secondary metabolites on floral visitors of Nicotiana attenuata". The Plant Journal. 49 (5): 840–854. doi:10.1111/j.1365-313X.2006.02995.x. PMID 17316174. Cite uses deprecated parameter |lastauthoramp= (help)
  2. ^ Baldwin, I.T.; et al. "Patterns and Consequences of Benzyl Acetone Floral Emissions from Nicotiana attenuata Plants". J. Chem. Ecol. 23 (100): 2327–2343.
  3. ^ Karl-Georg Fahlbusch, Franz-Josef Hammerschmidt, Johannes Panten, Wilhelm Pickenhagen, Dietmar Schatkowski, Kurt Bauer, Dorothea Garbe & Horst Surburg: Flavors and Fragrances, Ullmann's Encyclopedia of Industrial Chemistry, John Wiley & Sons, New York, 2003. Cited 28.8.2015.
  4. ^ "University of Florida Featured Creatures". Retrieved 2008-11-18.
  5. ^ "Answers.com webpage". Retrieved 2008-11-18.
  6. ^ "The Goods Company webpage". Retrieved 2008-11-18.

وصلات خارجية