بينزيل أسيتون
(تم التحويل من Benzylacetone)
![]() | |
الأسماء | |
---|---|
اسم أيوپاك المفضل
4-Phenylbutan-2-one | |
أسماء أخرى
4-Phenyl-2-butanone
Methyl 2-phenylethyl ketone | |
تمييز | |
رقم CAS | [ | ]
PubChem | |
SMILES |
|
InChI | InChI=1/C10H12O/c1-9(11)7-8-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3 |
الخصائص | |
الصيغة الجزيئية | C10H12O |
كتلة مولية | 148.2 g mol-1 |
الكثافة | 0.989 گ/م.ل. |
نقطة الانصهار | |
نقطة الغليان | |
المخاطر | |
نقطة الوميض | 98 °م (208 °ف; 371 ك) |
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa). | |
![]() ![]() ![]() | |
مراجع الجدول | |
البينزيل أسيتون Benzylacetone (تسمية الإيوپاك: 4-phenylbutan-2-one)، هو سائل حلو المذاق، ذو رائحة زهرية ويعتبر المركب الجاذب الأكثر وفرة في الزهور (مثل Coyote Tobacco, Nicotiana attenuata)[1][2] وواحداً من المكونات المتطايرة في الكاكاو.[3]
يمكن استخدامه كجاذب لذبابة البطيخ،[4][5] في العطور،[6] وكمادة معطرة في الصابون.
يمكن تحضيره بهدرجة البنزيليدن أسيتون.
. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .
انظر أيضاً
المصادر
- ^ Kessler, D. & Baldwin, I.T. (2007). "Making sense of nectar scents: the effects of nectar secondary metabolites on floral visitors of Nicotiana attenuata". The Plant Journal. 49 (5): 840–854. doi:10.1111/j.1365-313X.2006.02995.x. PMID 17316174. Cite uses deprecated parameter
|lastauthoramp=
(help) - ^ Baldwin, I.T.; et al. "Patterns and Consequences of Benzyl Acetone Floral Emissions from Nicotiana attenuata Plants". J. Chem. Ecol. 23 (100): 2327–2343.
- ^ Karl-Georg Fahlbusch, Franz-Josef Hammerschmidt, Johannes Panten, Wilhelm Pickenhagen, Dietmar Schatkowski, Kurt Bauer, Dorothea Garbe & Horst Surburg: Flavors and Fragrances, Ullmann's Encyclopedia of Industrial Chemistry, John Wiley & Sons, New York, 2003. Cited 28.8.2015.
- ^ "University of Florida Featured Creatures". Retrieved 2008-11-18.
- ^ "Answers.com webpage". Retrieved 2008-11-18.
- ^ "The Goods Company webpage". Retrieved 2008-11-18.