كربونات المغنيسيوم - Magnesium carbonate

هذه صفحة مكتوبة بالعربية البسيطة، انظر الصفحة الأصلية
كربونات المغنسيوم
Magnesium carbonate
Magnesium carbonate.png
Uhličitan hořečnatý.PNG
الأسماء
أسماء أخرى
مغنيسايت
Barringtonite (dihydrate)
Nesequehonite (trihydrate)
Lansfordite (pentahydrate)
تمييز
رقم CAS [546-93-0]
PubChem 11029
ChEBI 31793
رقم RTECS OM2470000
SMILES
InChI InChI=1/CH2O3.Mg/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2
الخصائص
الصيغة الجزيئية MgCO3
كتلة مولية 84.3139 غ/مول (anhydrous)
المظهر مادة صلبة بيضاء اللون
hygroscopic
الرائحة عديمة الرائحة
الكثافة 2.958 غ/سم3 (anhydrous)
2.825 غ/سم3 (dihydrate)
1.837 غ/سم3 (trihydrate)
1.73 غ/سم3 (pentahydrate)
نقطة الانصهار
قابلية الذوبان في الماء anhydrous:
0.0139 غ/100مل (25 °C)
0.00603 غ/100مل (100 °C)[2]
نتاج قابلية الذوبان، Ksp 10−7.8[1]
قابلية الذوبان soluble in acid, aqueous CO2
insoluble in acetone, ammonia
القابلية المغناطيسية −32.4·10−6 cm3/mol
معامل الانكسار (nD) 1.717 (anhydrous)
1.458 (dihydrate)
1.412 (trihydrate)
البنية
البنية البلورية Trigonal
الكيمياء الحرارية
الإنتالبية المعيارية
للتشكل
ΔfHo298
-1113 kJ/mol[3]
Standard molar
entropy
So298
65.7 J/mol·K[2][3]
سعة الحرارة النوعية، C 75.6 J/mol·K[2]
المخاطر
صفحة بيانات السلامة ICSC 0969
NFPA 704 (معيـَّن النار)
Flammability code 0: لن يشتعل. مثل الماءHealth code 1: التعرض سيتسبب في تهيجاً ولكن لا يترك سوى جروح طفيفة باقية. مثل زيت الترپنتينReactivity code 0: مستقر في العادة، حتى تحت ظروف التعرض للنار، ولا يتفاعل مع الماء. مثل النيتروجين السائلSpecial hazards (white): no codeNFPA 704 four-colored diamond
0
1
0
نقطة الوميض غير قابل للاشتعال
حدود التعرض الصحية بالولايات المتحدة (NIOSH):
PEL (المسموح)
TWA 15 مغ/م3 (الإجمالي) TWA 5 مغ/م3 (resp)[4]
مركبات ذا علاقة
بيكربونات الماغنسيوم
كربونات البريليوم
كربونات الكالسيوم
كربونات السترونتيوم
كربونات الباريوم
مركـّبات ذات علاقة
Artinite
Hydromagnesite
Dypingite
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
X mark.svgN verify (what is YesYX mark.svgN ?)
مراجع الجدول

كربونات المغنسيوم هو مركب كيميائي له الصيغة MgCO3، ويكون على شكل ملح أبيض اللون لا يذوب في الماء، وله استخدامات عديدة علاجياً وصناعياً وصيدلانياً.


. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

الخصائص[تحرير | عدل المصدر]

مسحوق أبيض ضخم عديم الرائحة، أو كتل خفيفة بيضاء هشة، عديم الانحلال عملياً في الماء، ولا ينحل في الكحول، لكن ينحل في الحموض الممدة مع فوران.


التحضير[تحرير | عدل المصدر]

التفاعلات[تحرير | عدل المصدر]

مع الأحماض[تحرير | عدل المصدر]

MgCO3 + 2 HCl → MgCl2 + CO2 + H2O
MgCO3 + H2SO4 → MgSO4 + CO2 + H2O

الانحلال[تحرير | عدل المصدر]

MgCO3 → MgO + CO2 (ΔH = +118 ك.ج/مول)


Mg(HCO3)(OH)•2(H2O) → Mg(HCO3)(OH)•(H2O) + H2O عند 157 °س
Mg(HCO3)(OH)•(H2O) → Mg(HCO3)(OH) + H2O عند 179 °س

الاستخدامات[تحرير | عدل المصدر]

  • علاجياً: تستعمل كربونات المغنسيوم كمادة مضادة للحموضة، كما أن لها تأثيراً مسهلاً تناضحياً.
  • صناعيا: يدخل في صناعة معاجين الأسنان وأدوات التجميل كالكريمات ويستخدم أيضا كمادة مالئة لتقوية البلاستيك وزيادة صلابته عند التصنيع[5].

الاستخدام الصيدلاني[تحرير | عدل المصدر]

يُستعمل كممدد في المضغوطات والمحافظ حيث يُستعمل بشكل رئيسي في مضغوطات الضغط المباشر بتراكيز أعلى من 45% وزن/وزن، كما يُستخدم أيضاً لادمصاص السوائل الداخلة في تركيب المضغوطة كالمطعمات و تُعد كربونات المغنسيوم غذاءً إضافياً ، أما علاجياً فيُستخدم كمضاد للحموضة.

الأمان[تحرير | عدل المصدر]

  • تم تصنيف كربونات المغنسيوم في فئة المواد غير السامة غير المخرشة لكن كما هو معروف فإن استخدام أملاح المغنسيوم ومنها كربونات المغنسيوم هو مُضاد استطباب لدى المصابين بقصور كلوي.
  • يتفاعل كربونات المغنسيوم في المعدة مع الحموضة المعديّة مشكلاً ملح كلوريد المغنيزيوم الذوّاب وثنائي أكسيد الكربون، لذلك لا يُنصح باستخدام كربونات المغنسيوم كمُضاد للحموضة للأشخاص الذين لا يحتملون حركة غاز ثاني أكسيد الكربون داخل المعدة.
  • يُمتص جزء من المغنسيوم ويُطرح عن طريق البول، كما يملك كربونات المغنسيوم خصائص مليّنة كأملاح المغنسيوم الأخرى وقد يُحدث إسهالات.


. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

حفظ المادة[تحرير | عدل المصدر]

يجب أن يحفظ في عبوات محكمة الإغلاق في أماكن جافة و باردة.

انظر أيضاً[تحرير | عدل المصدر]

المصادر والهوامش[تحرير | عدل المصدر]

  1. ^ Bénézeth, Pascale; Saldi, Giuseppe D.; Dandurand, Jean-Louis; Schott, Jacques (2011). "Experimental determination of the solubility product of magnesite at 50 to 200 °C". Chemical Geology. 286 (1–2): 21–31. doi:10.1016/j.chemgeo.2011.04.016.
  2. ^ أ ب ت http://chemister.ru/Database/properties-en.php?dbid=1&id=634
  3. ^ أ ب Zumdahl, Steven S. (2009). Chemical Principles 6th Ed. Houghton Mifflin Company. p. A22. ISBN 0-618-94690-X.
  4. ^ NIOSH Pocket Guide to Chemical Hazards 0373
  5. ^ استفسارات - بيوتات الكيمياء التعليمية.

وصلات خارجية[تحرير | عدل المصدر]

H2CO3 He
Li2CO3 BeCO3 B C N O F Ne
Na2CO3 MgCO3 Al Si P S Cl Ar
K2CO3 CaCO3 Sc Ti V Cr MnCO3 FeCO3 CoCO3 NiCO3 CuCO3 ZnCO3 Ga Ge As Se Br Kr
Rb2CO3 SrCO3 Y Zr Nb Mo Tc Ru Rh Pd Ag2CO3 CdCO3 In Sn Sb Te I Xe
Cs2CO3 BaCO3 Hf Ta W Re Os Ir Pt Au Hg Tl2CO3 PbCO3 Bi Po At Rn
Fr Ra Rf Db Sg Bh Hs Mt Ds Rg Cn Uut Uuq Uup Uuh Uus Uuo
La2(CO3)3 Ce Pr Nd Pm Sm Eu Gd Tb Dy Ho Er Tm Yb Lu
Ac Th Pa U Np Pu Am Cm Bk Cf Es Fm Md No Lr


الكلمات الدالة: