أسيتات الفضة

هذه صفحة مكتوبة بالعربية البسيطة، انظر الصفحة الأصلية
Silver acetate
Silver acetate
الأسماء
أسماء أخرى
Acetic acid, silver (1+) salt
Silver ethanoate
تمييز
رقم CAS [563-63-3]
PubChem 11246
رقم EC 209-254-9
رقم RTECS AJ4100000
SMILES
InChI InChI=1/C2H4O2.Ag/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1
الخصائص
الصيغة الجزيئية AgC2H3O2
كتلة مولية 166.912 g/mol
المظهر white to slightly grayish powder
slightly acidic odor
الكثافة 3.26 g/cm3, solid
نقطة الغليان
قابلية الذوبان في الماء 1.02 g/100 mL(20 °C)
القابلية المغناطيسية −60.4·10−6 cm3/mol
المخاطر
not listed
NFPA 704 (معيـَّن النار)
Flammability code 0: لن يشتعل. مثل الماءHealth code 1: التعرض سيتسبب في تهيجاً ولكن لا يترك سوى جروح طفيفة باقية. مثل زيت الترپنتينReactivity code 0: مستقر في العادة، حتى تحت ظروف التعرض للنار، ولا يتفاعل مع الماء. مثل النيتروجين السائلSpecial hazards (white): no codeNFPA 704 four-colored diamond
0
1
0
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
YesY verify (what is YesYX mark.svgN ?)
مراجع الجدول

خلات فضة مركب كيميائي له الصيغة AgC2H3O2 ، ويكون على شكل مسحوق بلوري أبيض إلى رمادي.

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

الخواص[تحرير | عدل المصدر]

التحضير[تحرير | عدل المصدر]

الاستخدامات[تحرير | عدل المصدر]

المصادر[تحرير | عدل المصدر]

  • F. H. MacDougall & S. Peterson (1947). "Equilibria in Silver Acetate Solutions". The Journal of Physical Chemistry. 51 (6): 1346–1361. doi:10.1021/j150456a009. PMID 20269041. Cite uses deprecated parameter |last-author-amp= (help)
تمّ الاسترجاع من "https://www.marefa.org/خلات_الفضة"