أسيتات السيزيوم

هذه صفحة مكتوبة بالعربية البسيطة، انظر الصفحة الأصلية
خلات السيزيوم[1]
Cesium acetate.png
الأسماء
اسم أيوباك
Caesium acetate
أسماء أخرى
Cesium acetate
تمييز
رقم CAS [3396-11-0]
PubChem 160687
SMILES
InChI InChI=1/C2H4O2.Cs/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1
الخصائص
الصيغة الجزيئية C2H3CsO2
كتلة مولية 191.94 g mol-1
المظهر عديم اللون، hygroscopic
الكثافة 2.423 g/cm3, solid
نقطة الانصهار
نقطة الغليان
قابلية الذوبان في الماء 945.1 g/100 g (−2.5 °C)
1345.5 g/100 ml (88.5 °C)
المخاطر
نقطة الوميض non-flammable
مركبات ذا علاقة
فورمات السيزيوم
خلات الليثيوم
خلات الصوديوم
خلات البوتاسيوم
خلات الروبيديوم
ما لم يُذكر غير ذلك، البيانات المعطاة للمواد في حالاتهم العيارية (عند 25 °س [77 °ف]، 100 kPa).
YesY verify (what is YesYX mark.svgN ?)
مراجع الجدول

خلات السيزيوم Caesium acetate مركب كيميائي له الصيغة CH3CO2Cs ، ويكون على شكل بلورات عديمة اللون .

. . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . . .

الهامش[تحرير | عدل المصدر]


للاستزادة[تحرير | عدل المصدر]

  • Torisawa, Yasuhiro; Okabe, Hiromitsu; Ikegami, Shiro (1984), "Efficient Inversions of Secondary Alcohols using Cesium Acetate and 18-Crown-6", Chem. Lett. 13 (9): 1555–56, doi:10.1246/cl.1984.1555 .

وصلات خارجية[تحرير | عدل المصدر]

تمّ الاسترجاع من "https://www.marefa.org/خلات_السيزيوم"